| Name | N-benzyl-N-methylaniline |
| Synonyms | METHYLBENZYLANILINE N-benzyl-N-methylaniline N-METHYL-N-BENZYLANILINE N-BENZYL N-METHYL ANILINE N-Methyl-N-phenylbenzylamine N-Benzyl-N-methylaniline for synthesis |
| CAS | 614-30-2 |
| EINECS | 210-375-4 |
| InChI | InChI=1/C14H15N/c1-15(14-10-6-3-7-11-14)12-13-8-4-2-5-9-13/h2-11H,12H2,1H3 |
| Molecular Formula | C14H15N |
| Molar Mass | 197.28 |
| Density | 1.048g/cm3 |
| Melting Point | 9.3°C |
| Boling Point | 316.2°C at 760 mmHg |
| Flash Point | 128.8°C |
| Vapor Presure | 0.000416mmHg at 25°C |
| pKa | 4.38±0.50(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.608 |
| Physical and Chemical Properties | Traits light yellow to brown oily matter. boiling point 311 ℃ freezing point 8 ℃ solubility: soluble in ethanol, ether, insoluble in water. |
| Use | For the synthesis of cationic dyes |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| HS Code | 2921 49 00 |
| Toxicity | LD50 orally in Rabbit: 2130 mg/kg |
| auto-ignition temperature | 450°C DIN 51794 |
| Solubility | 0.009g/l |
| freezing point | 8℃ |
| EPA chemical information | Benzenemethanamine, N-methyl-N-phenyl- (614-30-2) |